C11H21N3O4S — CID 76925217
N-(1,1-dioxothiolan-3-yl)-2-(N'-hydroxycarbamimidoyl)-N,3-dimethylbutanamide (PubChem CID 76925217) has the molecular formula C11H21N3O4S and a molecular weight of 291.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(N'-hydroxycarbamimidoyl)-N,3-dimethylbutanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(N'-hydroxycarbamimidoyl)-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 76925217 |
| Molecular Formula | C11H21N3O4S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(N'-hydroxycarbamimidoyl)-N,3-dimethylbutanamide |
| SMILES | CC(C)C(C(=O)N(C)C1CCS(=O)(=O)C1)C(N)=NO |
| InChI | InChI=1S/C11H21N3O4S/c1-7(2)9(10(12)13-16)11(15)14(3)8-4-5-19(17,18)6-8/h7-9,16H,4-6H2,1-3H3,(H2,12,13) |
| InChIKey | IIASJWDQPFTRTF-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|