C9H19N3O3S — CID 76883640
3-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxybutanimidamide (PubChem CID 76883640) has the molecular formula C9H19N3O3S and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxybutanimidamide.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 76883640 |
| Molecular Formula | C9H19N3O3S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxybutanimidamide |
| SMILES | CC(CC(N)=NO)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H19N3O3S/c1-7(5-9(10)11-13)12(2)8-3-4-16(14,15)6-8/h7-8,13H,3-6H2,1-2H3,(H2,10,11) |
| InChIKey | CZMVBQRAHCFCCW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|