C10H21N3O3S — CID 54966234
5-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxypentanimidamide (PubChem CID 54966234) has the molecular formula C10H21N3O3S and a molecular weight of 263.36 g/mol. Its IUPAC name is 5-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxypentanimidamide.
| Compound Name | 5-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 54966234 |
| Molecular Formula | C10H21N3O3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 5-[(1,1-dioxothiolan-3-yl)-methylamino]-N'-hydroxypentanimidamide |
| SMILES | CN(CCCCC(N)=NO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H21N3O3S/c1-13(6-3-2-4-10(11)12-14)9-5-7-17(15,16)8-9/h9,14H,2-8H2,1H3,(H2,11,12) |
| InChIKey | CKLKPORFSNSXGT-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|