C12H23N3O3S2 — CID 43648745
N-(3-amino-3-sulfanylidenepropyl)-3-[(1,1-dioxothiolan-3-yl)-methylamino]-N-methylpropanamide (PubChem CID 43648745) has the molecular formula C12H23N3O3S2 and a molecular weight of 321.47 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-3-[(1,1-dioxothiolan-3-yl)-methylamino]-N-methylpropanamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-3-[(1,1-dioxothiolan-3-yl)-methylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 43648745 |
| Molecular Formula | C12H23N3O3S2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-3-[(1,1-dioxothiolan-3-yl)-methylamino]-N-methylpropanamide |
| SMILES | CN(CCC(N)=S)C(=O)CCN(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H23N3O3S2/c1-14(10-5-8-20(17,18)9-10)7-4-12(16)15(2)6-3-11(13)19/h10H,3-9H2,1-2H3,(H2,13,19) |
| InChIKey | WZKSEEBVUJJJKR-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|