C11H23N3O2S — CID 65252742
4-[(1,1-dioxothiolan-3-yl)-methylamino]-2,2-dimethylbutanimidamide (PubChem CID 65252742) has the molecular formula C11H23N3O2S and a molecular weight of 261.39 g/mol. Its IUPAC name is 4-[(1,1-dioxothiolan-3-yl)-methylamino]-2,2-dimethylbutanimidamide.
| Compound Name | 4-[(1,1-dioxothiolan-3-yl)-methylamino]-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 65252742 |
| Molecular Formula | C11H23N3O2S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-[(1,1-dioxothiolan-3-yl)-methylamino]-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCN(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H23N3O2S/c1-11(2,10(12)13)5-6-14(3)9-4-7-17(15,16)8-9/h9H,4-8H2,1-3H3,(H3,12,13) |
| InChIKey | PACCTROUKGRAEP-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|