C14H21N3O2S — CID 64537074
3-[(1,1-dioxothiolan-3-yl)-methylamino]-2-phenylpropanimidamide (PubChem CID 64537074) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)-methylamino]-2-phenylpropanimidamide.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]-2-phenylpropanimidamide |
|---|---|
| PubChem CID | 64537074 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)-methylamino]-2-phenylpropanimidamide |
| SMILES | [H]/N=C(\N)C(CN(C)C1CCS(=O)(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C14H21N3O2S/c1-17(12-7-8-20(18,19)10-12)9-13(14(15)16)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3,(H3,15,16) |
| InChIKey | AKFMORWCDQVYAV-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|