C14H22N2O2S — CID 62780382
N-(1,1-dioxothiolan-3-yl)-N-methyl-1-phenylpropane-1,3-diamine (PubChem CID 62780382) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-1-phenylpropane-1,3-diamine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-1-phenylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62780382 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-1-phenylpropane-1,3-diamine |
| SMILES | CN(C1CCS(=O)(=O)C1)C(CCN)c1ccccc1 |
| InChI | InChI=1S/C14H22N2O2S/c1-16(13-8-10-19(17,18)11-13)14(7-9-15)12-5-3-2-4-6-12/h2-6,13-14H,7-11,15H2,1H3 |
| InChIKey | KZEAHKHAMKYVJW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |