C14H21NO3S — CID 82981785
4-[1-[(1,1-dioxothiolan-3-yl)-methylamino]propyl]phenol (PubChem CID 82981785) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 4-[1-[(1,1-dioxothiolan-3-yl)-methylamino]propyl]phenol.
| Compound Name | 4-[1-[(1,1-dioxothiolan-3-yl)-methylamino]propyl]phenol |
|---|---|
| PubChem CID | 82981785 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-[1-[(1,1-dioxothiolan-3-yl)-methylamino]propyl]phenol |
| SMILES | CCC(c1ccc(O)cc1)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H21NO3S/c1-3-14(11-4-6-13(16)7-5-11)15(2)12-8-9-19(17,18)10-12/h4-7,12,14,16H,3,8-10H2,1-2H3 |
| InChIKey | KCXKGWYSELXTRS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |