C13H18FNO3S — CID 82981552
2-[1-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]-5-fluorophenol (PubChem CID 82981552) has the molecular formula C13H18FNO3S and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[1-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]-5-fluorophenol.
| Compound Name | 2-[1-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]-5-fluorophenol |
|---|---|
| PubChem CID | 82981552 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-[1-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]-5-fluorophenol |
| SMILES | CC(c1ccc(F)cc1O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18FNO3S/c1-9(12-4-3-10(14)7-13(12)16)15(2)11-5-6-19(17,18)8-11/h3-4,7,9,11,16H,5-6,8H2,1-2H3 |
| InChIKey | JRRROPNPQXZMEC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|