C12H16FNO3S — CID 82976686
2-[1-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-5-fluorophenol (PubChem CID 82976686) has the molecular formula C12H16FNO3S and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[1-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-5-fluorophenol.
| Compound Name | 2-[1-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-5-fluorophenol |
|---|---|
| PubChem CID | 82976686 |
| Molecular Formula | C12H16FNO3S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-[1-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-5-fluorophenol |
| SMILES | CC(c1ccc(F)cc1O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H16FNO3S/c1-9(11-3-2-10(13)8-12(11)15)14-4-6-18(16,17)7-5-14/h2-3,8-9,15H,4-7H2,1H3 |
| InChIKey | JPRAGNPBADUKAP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|