C12H14FNO3 — CID 65072301
1-[1-(4-fluoro-2-hydroxyphenyl)ethyl]azetidine-3-carboxylic acid (PubChem CID 65072301) has the molecular formula C12H14FNO3 and a molecular weight of 239.25 g/mol. Its IUPAC name is 1-[1-(4-fluoro-2-hydroxyphenyl)ethyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[1-(4-fluoro-2-hydroxyphenyl)ethyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65072301 |
| Molecular Formula | C12H14FNO3 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 1-[1-(4-fluoro-2-hydroxyphenyl)ethyl]azetidine-3-carboxylic acid |
| SMILES | CC(c1ccc(F)cc1O)N1CC(C(=O)O)C1 |
| InChI | InChI=1S/C12H14FNO3/c1-7(14-5-8(6-14)12(16)17)10-3-2-9(13)4-11(10)15/h2-4,7-8,15H,5-6H2,1H3,(H,16,17) |
| InChIKey | IIZKGZTUJWZYSB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|