C14H20FNO3 — CID 103542218
2-[1-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-5-fluorophenol (PubChem CID 103542218) has the molecular formula C14H20FNO3 and a molecular weight of 269.32 g/mol. Its IUPAC name is 2-[1-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-5-fluorophenol.
| Compound Name | 2-[1-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-5-fluorophenol |
|---|---|
| PubChem CID | 103542218 |
| Molecular Formula | C14H20FNO3 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[1-(3,4-dimethoxypyrrolidin-1-yl)ethyl]-5-fluorophenol |
| SMILES | COC1CN(C(C)c2ccc(F)cc2O)CC1OC |
| InChI | InChI=1S/C14H20FNO3/c1-9(11-5-4-10(15)6-12(11)17)16-7-13(18-2)14(8-16)19-3/h4-6,9,13-14,17H,7-8H2,1-3H3 |
| InChIKey | WVHWVWUUDSZKSJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|