C14H20F2N2O2 — CID 103531886
2-(2,4-difluorophenyl)-2-(3,4-dimethoxypyrrolidin-1-yl)ethanamine (PubChem CID 103531886) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-2-(3,4-dimethoxypyrrolidin-1-yl)ethanamine.
| Compound Name | 2-(2,4-difluorophenyl)-2-(3,4-dimethoxypyrrolidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 103531886 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-(2,4-difluorophenyl)-2-(3,4-dimethoxypyrrolidin-1-yl)ethanamine |
| SMILES | COC1CN(C(CN)c2ccc(F)cc2F)CC1OC |
| InChI | InChI=1S/C14H20F2N2O2/c1-19-13-7-18(8-14(13)20-2)12(6-17)10-4-3-9(15)5-11(10)16/h3-5,12-14H,6-8,17H2,1-2H3 |
| InChIKey | XHJUDWMIXHAKJZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |