C9H11F2NO — CID 53276228
2-(2,4-difluorophenyl)-2-methoxyethanamine (PubChem CID 53276228) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-2-methoxyethanamine.
| Compound Name | 2-(2,4-difluorophenyl)-2-methoxyethanamine |
|---|---|
| PubChem CID | 53276228 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-(2,4-difluorophenyl)-2-methoxyethanamine |
| SMILES | COC(CN)c1ccc(F)cc1F |
| InChI | InChI=1S/C9H11F2NO/c1-13-9(5-12)7-3-2-6(10)4-8(7)11/h2-4,9H,5,12H2,1H3 |
| InChIKey | PEVOPAZHWALTCA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |