C11H16F2N2O — CID 62539902
1-(2,4-difluorophenyl)-N-(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 62539902) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-(2-methoxyethyl)ethane-1,2-diamine.
| Compound Name | 1-(2,4-difluorophenyl)-N-(2-methoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62539902 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | COCCNC(CN)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H16F2N2O/c1-16-5-4-15-11(7-14)9-3-2-8(12)6-10(9)13/h2-3,6,11,15H,4-5,7,14H2,1H3 |
| InChIKey | CERBIHPODKZWEF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|