methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate

C13H17F2NO2 — CID 65235593

IUPACmethyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate
SMILESCCCNC(CC(=O)OC)c1ccc(F)cc1F
InChIInChI=1S/C13H17F2NO2/c1-3-6-16-12(8-13(17)18-2)10-5-4-9(14)7-11(10)15/h4-5,7,12,16H,3,6,8H2,1-2H3
InChIKeyMJWCTAFZJKSQHJ-UHFFFAOYSA-N
MW257.28 g/mol
LogP2.57
Rot. Bonds6

About methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate

methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate (PubChem CID 65235593) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate.

Molecular Properties

Compound Namemethyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate
PubChem CID65235593
Molecular FormulaC13H17F2NO2
Molecular Weight257.28 g/mol
Exact Mass257.12
IUPAC Namemethyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate
SMILESCCCNC(CC(=O)OC)c1ccc(F)cc1F
InChIInChI=1S/C13H17F2NO2/c1-3-6-16-12(8-13(17)18-2)10-5-4-9(14)7-11(10)15/h4-5,7,12,16H,3,6,8H2,1-2H3
InChIKeyMJWCTAFZJKSQHJ-UHFFFAOYSA-N
XLogP2.57
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.28
LogP ≤ 52.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate?
The IUPAC name of methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate (CID 65235593) is methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate.
What is the SMILES notation for methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate?
The canonical SMILES for methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate is CCCNC(CC(=O)OC)c1ccc(F)cc1F.
What is the InChIKey of methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate?
The InChIKey is MJWCTAFZJKSQHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2NO2/c1-3-6-16-12(8-13(17)18-2)10-5-4-9(14)7-11(10)15/h4-5,7,12,16H,3,6,8H2,1-2H3.
What are the key properties of methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate?
methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate has a molecular weight of 257.28 g/mol, XLogP of 2.57, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,4-difluorophenyl)-3-(propylamino)propanoate is sourced from PubChem (CID 65235593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).