C11H16F2N2 — CID 62064444
1-(2,4-difluorophenyl)-N-propylethane-1,2-diamine (PubChem CID 62064444) has the molecular formula C11H16F2N2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-propylethane-1,2-diamine.
| Compound Name | 1-(2,4-difluorophenyl)-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 62064444 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-propylethane-1,2-diamine |
| SMILES | CCCNC(CN)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H16F2N2/c1-2-5-15-11(7-14)9-4-3-8(12)6-10(9)13/h3-4,6,11,15H,2,5,7,14H2,1H3 |
| InChIKey | OQZIZRQZHNKJPD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |