C10H14BrFN2 — CID 62066396
1-(4-bromo-2-fluorophenyl)-N-ethylethane-1,2-diamine (PubChem CID 62066396) has the molecular formula C10H14BrFN2 and a molecular weight of 261.14 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-N-ethylethane-1,2-diamine.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-N-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 62066396 |
| Molecular Formula | C10H14BrFN2 |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-N-ethylethane-1,2-diamine |
| SMILES | CCNC(CN)c1ccc(Br)cc1F |
| InChI | InChI=1S/C10H14BrFN2/c1-2-14-10(6-13)8-4-3-7(11)5-9(8)12/h3-5,10,14H,2,6,13H2,1H3 |
| InChIKey | PSBSCDFMHKHOBA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |