C16H21BrFN3 — CID 114906672
1-(4-bromo-2-fluorophenyl)-N-ethyl-2-(3-ethyl-1-methylpyrazol-5-yl)ethanamine (PubChem CID 114906672) has the molecular formula C16H21BrFN3 and a molecular weight of 354.27 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-N-ethyl-2-(3-ethyl-1-methylpyrazol-5-yl)ethanamine.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-N-ethyl-2-(3-ethyl-1-methylpyrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 114906672 |
| Molecular Formula | C16H21BrFN3 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-N-ethyl-2-(3-ethyl-1-methylpyrazol-5-yl)ethanamine |
| SMILES | CCNC(Cc1cc(CC)nn1C)c1ccc(Br)cc1F |
| InChI | InChI=1S/C16H21BrFN3/c1-4-12-9-13(21(3)20-12)10-16(19-5-2)14-7-6-11(17)8-15(14)18/h6-9,16,19H,4-5,10H2,1-3H3 |
| InChIKey | XAHNTUNTNQZZLQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |