C11H16F2N2O — CID 65378664
3-[[2-amino-1-(2,4-difluorophenyl)ethyl]amino]propan-1-ol (PubChem CID 65378664) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-[[2-amino-1-(2,4-difluorophenyl)ethyl]amino]propan-1-ol.
| Compound Name | 3-[[2-amino-1-(2,4-difluorophenyl)ethyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 65378664 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-[[2-amino-1-(2,4-difluorophenyl)ethyl]amino]propan-1-ol |
| SMILES | NCC(NCCCO)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H16F2N2O/c12-8-2-3-9(10(13)6-8)11(7-14)15-4-1-5-16/h2-3,6,11,15-16H,1,4-5,7,14H2 |
| InChIKey | PPJFMJCTPDNSCV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|