C12H18BrClN2O — CID 106841390
4-[[2-amino-1-(4-bromo-2-chlorophenyl)ethyl]amino]butan-1-ol (PubChem CID 106841390) has the molecular formula C12H18BrClN2O and a molecular weight of 321.65 g/mol. Its IUPAC name is 4-[[2-amino-1-(4-bromo-2-chlorophenyl)ethyl]amino]butan-1-ol.
| Compound Name | 4-[[2-amino-1-(4-bromo-2-chlorophenyl)ethyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 106841390 |
| Molecular Formula | C12H18BrClN2O |
| Molecular Weight | 321.65 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 4-[[2-amino-1-(4-bromo-2-chlorophenyl)ethyl]amino]butan-1-ol |
| SMILES | NCC(NCCCCO)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H18BrClN2O/c13-9-3-4-10(11(14)7-9)12(8-15)16-5-1-2-6-17/h3-4,7,12,16-17H,1-2,5-6,8,15H2 |
| InChIKey | JGDFCBHOLLNUQO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|