C11H19BrN2O2 — CID 107316996
5-[[2-amino-1-(5-bromofuran-2-yl)ethyl]amino]pentan-1-ol (PubChem CID 107316996) has the molecular formula C11H19BrN2O2 and a molecular weight of 291.19 g/mol. Its IUPAC name is 5-[[2-amino-1-(5-bromofuran-2-yl)ethyl]amino]pentan-1-ol.
| Compound Name | 5-[[2-amino-1-(5-bromofuran-2-yl)ethyl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 107316996 |
| Molecular Formula | C11H19BrN2O2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 5-[[2-amino-1-(5-bromofuran-2-yl)ethyl]amino]pentan-1-ol |
| SMILES | NCC(NCCCCCO)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H19BrN2O2/c12-11-5-4-10(16-11)9(8-13)14-6-2-1-3-7-15/h4-5,9,14-15H,1-3,6-8,13H2 |
| InChIKey | BAMCTPCNZMEHQQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|