C10H17BrN2O — CID 104652736
N'-[1-(5-bromofuran-2-yl)ethyl]butane-1,4-diamine (PubChem CID 104652736) has the molecular formula C10H17BrN2O and a molecular weight of 261.16 g/mol. Its IUPAC name is N'-[1-(5-bromofuran-2-yl)ethyl]butane-1,4-diamine.
| Compound Name | N'-[1-(5-bromofuran-2-yl)ethyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 104652736 |
| Molecular Formula | C10H17BrN2O |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | N'-[1-(5-bromofuran-2-yl)ethyl]butane-1,4-diamine |
| SMILES | CC(NCCCCN)c1ccc(Br)o1 |
| InChI | InChI=1S/C10H17BrN2O/c1-8(13-7-3-2-6-12)9-4-5-10(11)14-9/h4-5,8,13H,2-3,6-7,12H2,1H3 |
| InChIKey | GALYAERCAQHCCF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|