C10H12BrNO — CID 104653023
N-[1-(5-bromofuran-2-yl)ethyl]but-3-yn-1-amine (PubChem CID 104653023) has the molecular formula C10H12BrNO and a molecular weight of 242.12 g/mol. Its IUPAC name is N-[1-(5-bromofuran-2-yl)ethyl]but-3-yn-1-amine.
| Compound Name | N-[1-(5-bromofuran-2-yl)ethyl]but-3-yn-1-amine |
|---|---|
| PubChem CID | 104653023 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | N-[1-(5-bromofuran-2-yl)ethyl]but-3-yn-1-amine |
| SMILES | C#CCCNC(C)c1ccc(Br)o1 |
| InChI | InChI=1S/C10H12BrNO/c1-3-4-7-12-8(2)9-5-6-10(11)13-9/h1,5-6,8,12H,4,7H2,2H3 |
| InChIKey | BGQYXPLNEQRMTP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|