C13H20Cl2N2O — CID 107316920
5-[[2-amino-1-(3,4-dichlorophenyl)ethyl]amino]pentan-1-ol (PubChem CID 107316920) has the molecular formula C13H20Cl2N2O and a molecular weight of 291.22 g/mol. Its IUPAC name is 5-[[2-amino-1-(3,4-dichlorophenyl)ethyl]amino]pentan-1-ol.
| Compound Name | 5-[[2-amino-1-(3,4-dichlorophenyl)ethyl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 107316920 |
| Molecular Formula | C13H20Cl2N2O |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 5-[[2-amino-1-(3,4-dichlorophenyl)ethyl]amino]pentan-1-ol |
| SMILES | NCC(NCCCCCO)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H20Cl2N2O/c14-11-5-4-10(8-12(11)15)13(9-16)17-6-2-1-3-7-18/h4-5,8,13,17-18H,1-3,6-7,9,16H2 |
| InChIKey | TWYSSQYFZNUWOF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|