C15H26N2O — CID 107316866
5-[[2-amino-1-(3,5-dimethylphenyl)ethyl]amino]pentan-1-ol (PubChem CID 107316866) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 5-[[2-amino-1-(3,5-dimethylphenyl)ethyl]amino]pentan-1-ol.
| Compound Name | 5-[[2-amino-1-(3,5-dimethylphenyl)ethyl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 107316866 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 5-[[2-amino-1-(3,5-dimethylphenyl)ethyl]amino]pentan-1-ol |
| SMILES | Cc1cc(C)cc(C(CN)NCCCCCO)c1 |
| InChI | InChI=1S/C15H26N2O/c1-12-8-13(2)10-14(9-12)15(11-16)17-6-4-3-5-7-18/h8-10,15,17-18H,3-7,11,16H2,1-2H3 |
| InChIKey | ZSRUMUGUEWIUNQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|