C11H19BrN2OS — CID 107317095
5-[[2-amino-1-(4-bromothiophen-2-yl)ethyl]amino]pentan-1-ol (PubChem CID 107317095) has the molecular formula C11H19BrN2OS and a molecular weight of 307.26 g/mol. Its IUPAC name is 5-[[2-amino-1-(4-bromothiophen-2-yl)ethyl]amino]pentan-1-ol.
| Compound Name | 5-[[2-amino-1-(4-bromothiophen-2-yl)ethyl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 107317095 |
| Molecular Formula | C11H19BrN2OS |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 5-[[2-amino-1-(4-bromothiophen-2-yl)ethyl]amino]pentan-1-ol |
| SMILES | NCC(NCCCCCO)c1cc(Br)cs1 |
| InChI | InChI=1S/C11H19BrN2OS/c12-9-6-11(16-8-9)10(7-13)14-4-2-1-3-5-15/h6,8,10,14-15H,1-5,7,13H2 |
| InChIKey | QPUQIRJKIPLCAU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|