C9H15BrN2S — CID 116949322
1-(4-bromothiophen-2-yl)-N-methylbutane-1,4-diamine (PubChem CID 116949322) has the molecular formula C9H15BrN2S and a molecular weight of 263.20 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-N-methylbutane-1,4-diamine.
| Compound Name | 1-(4-bromothiophen-2-yl)-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116949322 |
| Molecular Formula | C9H15BrN2S |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-N-methylbutane-1,4-diamine |
| SMILES | CNC(CCCN)c1cc(Br)cs1 |
| InChI | InChI=1S/C9H15BrN2S/c1-12-8(3-2-4-11)9-5-7(10)6-13-9/h5-6,8,12H,2-4,11H2,1H3 |
| InChIKey | AMYKUJFZUCLVOZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |