C10H17BrN2S — CID 116949880
1-(4-bromothiophen-2-yl)-1-N-methylpentane-1,4-diamine (PubChem CID 116949880) has the molecular formula C10H17BrN2S and a molecular weight of 277.23 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-1-N-methylpentane-1,4-diamine.
| Compound Name | 1-(4-bromothiophen-2-yl)-1-N-methylpentane-1,4-diamine |
|---|---|
| PubChem CID | 116949880 |
| Molecular Formula | C10H17BrN2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-1-N-methylpentane-1,4-diamine |
| SMILES | CNC(CCC(C)N)c1cc(Br)cs1 |
| InChI | InChI=1S/C10H17BrN2S/c1-7(12)3-4-9(13-2)10-5-8(11)6-14-10/h5-7,9,13H,3-4,12H2,1-2H3 |
| InChIKey | POGGZMUFMURYHP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |