C7H11BrN2S — CID 131145468
(1R)-1-(4-bromothiophen-2-yl)propane-1,3-diamine (PubChem CID 131145468) has the molecular formula C7H11BrN2S and a molecular weight of 235.15 g/mol. Its IUPAC name is (1R)-1-(4-bromothiophen-2-yl)propane-1,3-diamine.
| Compound Name | (1R)-1-(4-bromothiophen-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 131145468 |
| Molecular Formula | C7H11BrN2S |
| Molecular Weight | 235.15 g/mol |
| Exact Mass | 233.98 |
| IUPAC Name | (1R)-1-(4-bromothiophen-2-yl)propane-1,3-diamine |
| SMILES | NCC[C@@H](N)c1cc(Br)cs1 |
| InChI | InChI=1S/C7H11BrN2S/c8-5-3-7(11-4-5)6(10)1-2-9/h3-4,6H,1-2,9-10H2/t6-/m1/s1 |
| InChIKey | VOCLOWJHLBMMJJ-ZCFIWIBFSA-N |
| XLogP | 1.86 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.15 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |