C11H18Br2N2OS — CID 107316823
5-[[2-amino-1-(4,5-dibromothiophen-2-yl)ethyl]amino]pentan-1-ol (PubChem CID 107316823) has the molecular formula C11H18Br2N2OS and a molecular weight of 386.15 g/mol. Its IUPAC name is 5-[[2-amino-1-(4,5-dibromothiophen-2-yl)ethyl]amino]pentan-1-ol.
| Compound Name | 5-[[2-amino-1-(4,5-dibromothiophen-2-yl)ethyl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 107316823 |
| Molecular Formula | C11H18Br2N2OS |
| Molecular Weight | 386.15 g/mol |
| Exact Mass | 383.95 |
| IUPAC Name | 5-[[2-amino-1-(4,5-dibromothiophen-2-yl)ethyl]amino]pentan-1-ol |
| SMILES | NCC(NCCCCCO)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H18Br2N2OS/c12-8-6-10(17-11(8)13)9(7-14)15-4-2-1-3-5-16/h6,9,15-16H,1-5,7,14H2 |
| InChIKey | PQXWMVNDBSLCLI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.15 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|