C8H12Br2N2S — CID 102839030
1-(4,5-dibromothiophen-2-yl)-N-ethylethane-1,2-diamine (PubChem CID 102839030) has the molecular formula C8H12Br2N2S and a molecular weight of 328.07 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-N-ethylethane-1,2-diamine.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-N-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 102839030 |
| Molecular Formula | C8H12Br2N2S |
| Molecular Weight | 328.07 g/mol |
| Exact Mass | 325.91 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-N-ethylethane-1,2-diamine |
| SMILES | CCNC(CN)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C8H12Br2N2S/c1-2-12-6(4-11)7-3-5(9)8(10)13-7/h3,6,12H,2,4,11H2,1H3 |
| InChIKey | VIHXCAKQYWWSII-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.07 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |