C12H17Br2NS — CID 104987151
1-(4,5-dibromothiophen-2-yl)-N-ethylhex-5-en-1-amine (PubChem CID 104987151) has the molecular formula C12H17Br2NS and a molecular weight of 367.15 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-N-ethylhex-5-en-1-amine.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-N-ethylhex-5-en-1-amine |
|---|---|
| PubChem CID | 104987151 |
| Molecular Formula | C12H17Br2NS |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-N-ethylhex-5-en-1-amine |
| SMILES | C=CCCCC(NCC)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H17Br2NS/c1-3-5-6-7-10(15-4-2)11-8-9(13)12(14)16-11/h3,8,10,15H,1,4-7H2,2H3 |
| InChIKey | XMAUPMLYCMYNQB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|