C15H25Br2NS — CID 80535572
1-(4,5-dibromothiophen-2-yl)-N-propyloctan-1-amine (PubChem CID 80535572) has the molecular formula C15H25Br2NS and a molecular weight of 411.25 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-N-propyloctan-1-amine.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-N-propyloctan-1-amine |
|---|---|
| PubChem CID | 80535572 |
| Molecular Formula | C15H25Br2NS |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-N-propyloctan-1-amine |
| SMILES | CCCCCCCC(NCCC)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C15H25Br2NS/c1-3-5-6-7-8-9-13(18-10-4-2)14-11-12(16)15(17)19-14/h11,13,18H,3-10H2,1-2H3 |
| InChIKey | MQRPNKYLHMLVPS-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|