C11H17Br2NOS — CID 105007809
N-[1-(4,5-dibromothiophen-2-yl)-2-ethoxyethyl]propan-1-amine (PubChem CID 105007809) has the molecular formula C11H17Br2NOS and a molecular weight of 371.14 g/mol. Its IUPAC name is N-[1-(4,5-dibromothiophen-2-yl)-2-ethoxyethyl]propan-1-amine.
| Compound Name | N-[1-(4,5-dibromothiophen-2-yl)-2-ethoxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 105007809 |
| Molecular Formula | C11H17Br2NOS |
| Molecular Weight | 371.14 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | N-[1-(4,5-dibromothiophen-2-yl)-2-ethoxyethyl]propan-1-amine |
| SMILES | CCCNC(COCC)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H17Br2NOS/c1-3-5-14-9(7-15-4-2)10-6-8(12)11(13)16-10/h6,9,14H,3-5,7H2,1-2H3 |
| InChIKey | IDMBOQMJCNMWNV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.14 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |