C16H25Br3S — CID 80534369
2,3-dibromo-5-(1-bromododecyl)thiophene (PubChem CID 80534369) has the molecular formula C16H25Br3S and a molecular weight of 489.16 g/mol. Its IUPAC name is 2,3-dibromo-5-(1-bromododecyl)thiophene.
| Compound Name | 2,3-dibromo-5-(1-bromododecyl)thiophene |
|---|---|
| PubChem CID | 80534369 |
| Molecular Formula | C16H25Br3S |
| Molecular Weight | 489.16 g/mol |
| Exact Mass | 485.92 |
| IUPAC Name | 2,3-dibromo-5-(1-bromododecyl)thiophene |
| SMILES | CCCCCCCCCCCC(Br)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C16H25Br3S/c1-2-3-4-5-6-7-8-9-10-11-13(17)15-12-14(18)16(19)20-15/h12-13H,2-11H2,1H3 |
| InChIKey | UGCMJUJYENJQIM-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.16 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|