C14H24Br2N2S — CID 105293426
1-(4,5-dibromothiophen-2-yl)decylhydrazine (PubChem CID 105293426) has the molecular formula C14H24Br2N2S and a molecular weight of 412.24 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)decylhydrazine.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)decylhydrazine |
|---|---|
| PubChem CID | 105293426 |
| Molecular Formula | C14H24Br2N2S |
| Molecular Weight | 412.24 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)decylhydrazine |
| SMILES | CCCCCCCCCC(NN)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C14H24Br2N2S/c1-2-3-4-5-6-7-8-9-12(18-17)13-10-11(15)14(16)19-13/h10,12,18H,2-9,17H2,1H3 |
| InChIKey | OUNBCGQTXYELKH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.24 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|