C15H28N2S — CID 105294364
1-(4,5-dimethylthiophen-2-yl)nonylhydrazine (PubChem CID 105294364) has the molecular formula C15H28N2S and a molecular weight of 268.47 g/mol. Its IUPAC name is 1-(4,5-dimethylthiophen-2-yl)nonylhydrazine.
| Compound Name | 1-(4,5-dimethylthiophen-2-yl)nonylhydrazine |
|---|---|
| PubChem CID | 105294364 |
| Molecular Formula | C15H28N2S |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 1-(4,5-dimethylthiophen-2-yl)nonylhydrazine |
| SMILES | CCCCCCCCC(NN)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C15H28N2S/c1-4-5-6-7-8-9-10-14(17-16)15-11-12(2)13(3)18-15/h11,14,17H,4-10,16H2,1-3H3 |
| InChIKey | NFSNTYYNYBJPEK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|