C18H32N2S — CID 105298347
1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)undecylhydrazine (PubChem CID 105298347) has the molecular formula C18H32N2S and a molecular weight of 308.54 g/mol. Its IUPAC name is 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)undecylhydrazine.
| Compound Name | 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)undecylhydrazine |
|---|---|
| PubChem CID | 105298347 |
| Molecular Formula | C18H32N2S |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)undecylhydrazine |
| SMILES | CCCCCCCCCCC(NN)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C18H32N2S/c1-2-3-4-5-6-7-8-9-12-16(20-19)18-14-15-11-10-13-17(15)21-18/h14,16,20H,2-13,19H2,1H3 |
| InChIKey | GWFPFGUDPYQVRE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|