C19H33NS — CID 115831741
N-methyl-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)decan-1-amine (PubChem CID 115831741) has the molecular formula C19H33NS and a molecular weight of 307.55 g/mol. Its IUPAC name is N-methyl-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)decan-1-amine.
| Compound Name | N-methyl-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)decan-1-amine |
|---|---|
| PubChem CID | 115831741 |
| Molecular Formula | C19H33NS |
| Molecular Weight | 307.55 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-methyl-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)decan-1-amine |
| SMILES | CCCCCCCCCC(NC)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C19H33NS/c1-3-4-5-6-7-8-9-13-17(20-2)19-15-16-12-10-11-14-18(16)21-19/h15,17,20H,3-14H2,1-2H3 |
| InChIKey | DSZAOBKBYFIRQH-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|