C14H24N2OS — CID 103026377
[1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-4-methoxy-4-methylpentyl]hydrazine (PubChem CID 103026377) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is [1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-4-methoxy-4-methylpentyl]hydrazine.
| Compound Name | [1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-4-methoxy-4-methylpentyl]hydrazine |
|---|---|
| PubChem CID | 103026377 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | [1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-4-methoxy-4-methylpentyl]hydrazine |
| SMILES | COC(C)(C)CCC(NN)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C14H24N2OS/c1-14(2,17-3)8-7-11(16-15)13-9-10-5-4-6-12(10)18-13/h9,11,16H,4-8,15H2,1-3H3 |
| InChIKey | COABPYDVDVOAPQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|