C16H23N3S2 — CID 105324951
[2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]hydrazine (PubChem CID 105324951) has the molecular formula C16H23N3S2 and a molecular weight of 321.52 g/mol. Its IUPAC name is [2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]hydrazine.
| Compound Name | [2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105324951 |
| Molecular Formula | C16H23N3S2 |
| Molecular Weight | 321.52 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | [2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]hydrazine |
| SMILES | CC(C)(C)c1csc(CC(NN)c2cc3c(s2)CCC3)n1 |
| InChI | InChI=1S/C16H23N3S2/c1-16(2,3)14-9-20-15(18-14)8-11(19-17)13-7-10-5-4-6-12(10)21-13/h7,9,11,19H,4-6,8,17H2,1-3H3 |
| InChIKey | MLYDEMDIIZJONF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|