C18H24N2S — CID 105287656
[2-(2,5-dimethylphenyl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethyl]hydrazine (PubChem CID 105287656) has the molecular formula C18H24N2S and a molecular weight of 300.47 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethyl]hydrazine.
| Compound Name | [2-(2,5-dimethylphenyl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105287656 |
| Molecular Formula | C18H24N2S |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethyl]hydrazine |
| SMILES | Cc1ccc(C)c(CC(NN)c2cc3c(s2)CCCC3)c1 |
| InChI | InChI=1S/C18H24N2S/c1-12-7-8-13(2)15(9-12)10-16(20-19)18-11-14-5-3-4-6-17(14)21-18/h7-9,11,16,20H,3-6,10,19H2,1-2H3 |
| InChIKey | MGEKNAQHYQLJAM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|