C16H19FN2OS — CID 105334246
[1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(2-fluoro-3-methoxyphenyl)ethyl]hydrazine (PubChem CID 105334246) has the molecular formula C16H19FN2OS and a molecular weight of 306.41 g/mol. Its IUPAC name is [1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(2-fluoro-3-methoxyphenyl)ethyl]hydrazine.
| Compound Name | [1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(2-fluoro-3-methoxyphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105334246 |
| Molecular Formula | C16H19FN2OS |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | [1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2-(2-fluoro-3-methoxyphenyl)ethyl]hydrazine |
| SMILES | COc1cccc(CC(NN)c2cc3c(s2)CCC3)c1F |
| InChI | InChI=1S/C16H19FN2OS/c1-20-13-6-2-5-11(16(13)17)8-12(19-18)15-9-10-4-3-7-14(10)21-15/h2,5-6,9,12,19H,3-4,7-8,18H2,1H3 |
| InChIKey | IOFXBIYKAJVWMS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|