C15H16Cl2N2S — CID 105293121
[2-(2,6-dichlorophenyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]hydrazine (PubChem CID 105293121) has the molecular formula C15H16Cl2N2S and a molecular weight of 327.28 g/mol. Its IUPAC name is [2-(2,6-dichlorophenyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]hydrazine.
| Compound Name | [2-(2,6-dichlorophenyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105293121 |
| Molecular Formula | C15H16Cl2N2S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | [2-(2,6-dichlorophenyl)-1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1c(Cl)cccc1Cl)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C15H16Cl2N2S/c16-11-4-2-5-12(17)10(11)8-13(19-18)15-7-9-3-1-6-14(9)20-15/h2,4-5,7,13,19H,1,3,6,8,18H2 |
| InChIKey | YHRSEOUAYZLBHL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|