C15H17ClN2S — CID 105287303
[(2-chlorophenyl)-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methyl]hydrazine (PubChem CID 105287303) has the molecular formula C15H17ClN2S and a molecular weight of 292.83 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methyl]hydrazine.
| Compound Name | [(2-chlorophenyl)-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105287303 |
| Molecular Formula | C15H17ClN2S |
| Molecular Weight | 292.83 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | [(2-chlorophenyl)-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methyl]hydrazine |
| SMILES | NNC(c1cc2c(s1)CCCC2)c1ccccc1Cl |
| InChI | InChI=1S/C15H17ClN2S/c16-12-7-3-2-6-11(12)15(18-17)14-9-10-5-1-4-8-13(10)19-14/h2-3,6-7,9,15,18H,1,4-5,8,17H2 |
| InChIKey | XISZXYOKKPHQMM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.83 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|