C17H21ClN2S — CID 107562528
[(3-chloro-4-methylphenyl)-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)methyl]hydrazine (PubChem CID 107562528) has the molecular formula C17H21ClN2S and a molecular weight of 320.89 g/mol. Its IUPAC name is [(3-chloro-4-methylphenyl)-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)methyl]hydrazine.
| Compound Name | [(3-chloro-4-methylphenyl)-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107562528 |
| Molecular Formula | C17H21ClN2S |
| Molecular Weight | 320.89 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | [(3-chloro-4-methylphenyl)-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)methyl]hydrazine |
| SMILES | Cc1ccc(C(NN)c2cc3c(s2)CCCCC3)cc1Cl |
| InChI | InChI=1S/C17H21ClN2S/c1-11-7-8-13(9-14(11)18)17(20-19)16-10-12-5-3-2-4-6-15(12)21-16/h7-10,17,20H,2-6,19H2,1H3 |
| InChIKey | YEYYAFQKXHJURO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.89 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|