C15H17ClN2S2 — CID 107562677
[(3-chloro-4-methylphenyl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methyl]hydrazine (PubChem CID 107562677) has the molecular formula C15H17ClN2S2 and a molecular weight of 324.90 g/mol. Its IUPAC name is [(3-chloro-4-methylphenyl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methyl]hydrazine.
| Compound Name | [(3-chloro-4-methylphenyl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107562677 |
| Molecular Formula | C15H17ClN2S2 |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | [(3-chloro-4-methylphenyl)-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)methyl]hydrazine |
| SMILES | Cc1ccc(C(NN)c2cc3c(s2)CCSC3)cc1Cl |
| InChI | InChI=1S/C15H17ClN2S2/c1-9-2-3-10(6-12(9)16)15(18-17)14-7-11-8-19-5-4-13(11)20-14/h2-3,6-7,15,18H,4-5,8,17H2,1H3 |
| InChIKey | IUEWZTIMSMHUHK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|