C17H22N2S2 — CID 105312835
[6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl-(2,4,5-trimethylphenyl)methyl]hydrazine (PubChem CID 105312835) has the molecular formula C17H22N2S2 and a molecular weight of 318.51 g/mol. Its IUPAC name is [6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl-(2,4,5-trimethylphenyl)methyl]hydrazine.
| Compound Name | [6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl-(2,4,5-trimethylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105312835 |
| Molecular Formula | C17H22N2S2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | [6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl-(2,4,5-trimethylphenyl)methyl]hydrazine |
| SMILES | Cc1cc(C)c(C(NN)c2cc3c(s2)CCSC3)cc1C |
| InChI | InChI=1S/C17H22N2S2/c1-10-6-12(3)14(7-11(10)2)17(19-18)16-8-13-9-20-5-4-15(13)21-16/h6-8,17,19H,4-5,9,18H2,1-3H3 |
| InChIKey | OMKUGTYSANGBOK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|