C12H20N2S2 — CID 105305244
[1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-2,2-dimethylpropyl]hydrazine (PubChem CID 105305244) has the molecular formula C12H20N2S2 and a molecular weight of 256.44 g/mol. Its IUPAC name is [1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-2,2-dimethylpropyl]hydrazine.
| Compound Name | [1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-2,2-dimethylpropyl]hydrazine |
|---|---|
| PubChem CID | 105305244 |
| Molecular Formula | C12H20N2S2 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | [1-(6,7-dihydro-4H-thieno[3,2-c]thiopyran-2-yl)-2,2-dimethylpropyl]hydrazine |
| SMILES | CC(C)(C)C(NN)c1cc2c(s1)CCSC2 |
| InChI | InChI=1S/C12H20N2S2/c1-12(2,3)11(14-13)10-6-8-7-15-5-4-9(8)16-10/h6,11,14H,4-5,7,13H2,1-3H3 |
| InChIKey | ZWHQTVKYZAJLKJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|